CymitQuimica logo

CAS 86632-92-0

:

3-nitrooxetane

Description:
3-Nitrooxetane is a chemical compound characterized by its unique oxetane ring structure, which consists of a four-membered cyclic ether. The presence of a nitro group at the 3-position of the oxetane ring contributes to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It exhibits properties common to nitro compounds, such as being polar and having a relatively high density compared to hydrocarbons. 3-Nitrooxetane can participate in various chemical reactions, including nucleophilic substitutions and ring-opening reactions, making it a valuable intermediate in the synthesis of more complex organic molecules. Its stability can be influenced by factors such as temperature and the presence of other reactive species. As with many nitro compounds, safety precautions should be taken when handling 3-nitrooxetane due to its potential toxicity and explosive nature under certain conditions.
Formula:C3H5NO3
InChI:InChI=1/C3H5NO3/c5-4(6)3-1-7-2-3/h3H,1-2H2
SMILES:C1C(CO1)N(=O)=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.