CAS 866332-19-6
:B-(1,2-Dimethyl-1H-benzimidazol-6-yl)boronic acid
Description:
B-(1,2-Dimethyl-1H-benzimidazol-6-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a substituted benzimidazole moiety. This compound typically exhibits properties such as being a white to off-white solid, with solubility in polar solvents like water and alcohols, which is common for boronic acids. The presence of the dimethyl and benzimidazole groups contributes to its potential biological activity and reactivity, particularly in forming reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. Boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in organic synthesis for forming carbon-carbon bonds. Additionally, the compound may exhibit properties such as pH sensitivity due to the boronic acid group, which can influence its behavior in biological systems. Overall, B-(1,2-Dimethyl-1H-benzimidazol-6-yl)boronic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C9H11BN2O2
InChI:InChI=1S/C9H11BN2O2/c1-6-11-8-4-3-7(10(13)14)5-9(8)12(6)2/h3-5,13-14H,1-2H3
InChI key:InChIKey=PIZRHUKYZFZXCB-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1C)=CC=C(B(O)O)C2
Synonyms:- Boronic acid, B-(1,2-dimethyl-1H-benzimidazol-6-yl)-
- B-(1,2-Dimethyl-1H-benzimidazol-6-yl)boronic acid
- (1,2-Dimethyl-1H-1,3-benzodiazol-6-yl)boronic acid
- Boronic acid, (1,2-dimethyl-1H-benzimidazol-6-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
