CAS 866363-71-5

6-[(6-Azido-1-oxohexyl)amino]hexanoic acid

Description:

6-[(6-Azido-1-oxohexyl)amino]hexanoic acid, with the CAS number 866363-71-5, is a chemical compound characterized by its unique functional groups and structure. It features an azido group, which is known for its reactivity and potential applications in click chemistry, making it valuable in bioconjugation and labeling studies. The presence of an amino group indicates that it can participate in various chemical reactions, including peptide bond formation. The hexanoic acid moiety contributes to its hydrophobic characteristics, while the oxohexyl segment enhances its molecular complexity. This compound is likely to be soluble in polar solvents due to the carboxylic acid group, while its azido and amino functionalities may allow for diverse interactions with biological molecules. Overall, 6-[(6-Azido-1-oxohexyl)amino]hexanoic acid is a versatile building block in organic synthesis and biochemistry, with potential applications in drug development and materials science.

Formula: C₁₂H₂₂N₄O₃

InChI: InChI=1S/C12H22N4O3/c13-16-15-10-6-1-3-7-11(17)14-9-5-2-4-8-12(18)19/h1-10H2,(H,14,17)(H,18,19)

InChI key: InChIKey=AEPIYQTVXFLWBW-UHFFFAOYSA-N

SMILES: C(NCCCCCC(O)=O)(CCCCCN=[N+]=[N-])=O

Synonyms:

• Hexanoic acid, 6-[(6-azido-1-oxohexyl)amino]-
• 6-[(6-Azido-1-oxohexyl)amino]hexanoic acid

6-(6-Azidohexanamido)hexanoic acid

CAS: 866363-71-5

6-(6-Azidohexanamido)hexanoic acid

Purity: 98%

Molecular weight: 270.33g/mol

Ref: 54-OR1063331

N3-Aca-Aca-OH

CAS: 866363-71-5

N3-Aca-Aca-OH is a click chemistry reagent characterized by the presence of an azide group. Click chemistry exhibits vast potential for linking nucleic acids, lipids, proteins, and other molecules due to its high yield, specificity, and simplicity. These beneficial properties have led to its application across various research fields.

Formula: C₁₂H₂₂N₄O₃

Color and Shape: Solid

Molecular weight: 270.33

Ref: TM-T89759