CymitQuimica logo

CAS 866472-96-0

:

3-amino-6-fluoro-quinolin-4-ol

Description:
3-Amino-6-fluoro-quinolin-4-ol is a chemical compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of an amino group (-NH2) at the 3-position and a fluoro group (-F) at the 6-position, along with a hydroxyl group (-OH) at the 4-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group. It may also display biological activity, making it of interest in medicinal chemistry and drug development. The fluorine atom can enhance the compound's lipophilicity and metabolic stability, potentially influencing its pharmacokinetic properties. Additionally, the compound's structure allows for various chemical modifications, which can be explored for developing derivatives with improved efficacy or selectivity in biological applications. As with many quinoline derivatives, it may also exhibit fluorescence, making it useful in certain analytical applications.
Formula:C9H7FN2O
InChI:InChI=1/C9H7FN2O/c10-5-1-2-8-6(3-5)9(13)7(11)4-12-8/h1-4H,11H2,(H,12,13)
SMILES:c1cc2c(cc1F)c(=O)c(c[nH]2)N
Synonyms:
  • 3-Amino-6-fluoroquinolin-4-ol
  • 4-Quinolinol, 3-amino-6-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.