CAS 86649-57-2
:3-Pyridyloxyacetic acid
Description:
3-Pyridyloxyacetic acid is an organic compound characterized by its pyridine ring structure, which is substituted with a hydroxyl group and an acetic acid moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its functional groups. It exhibits properties typical of both pyridine derivatives and carboxylic acids, including potential acidity due to the carboxyl group and the ability to participate in hydrogen bonding. 3-Pyridyloxyacetic acid is of interest in various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate or active ingredient. Its biological activity can be attributed to the presence of the pyridine ring, which is known to interact with various biological targets. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many chemical substances, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C7H7NO3
InChI:InChI=1/C7H7NO3/c9-7(10)5-11-6-2-1-3-8-4-6/h1-4H,5H2,(H,9,10)
SMILES:c1cc(cnc1)OCC(=O)O
Synonyms:- Acetic Acid, 2-(3-Pyridinyloxy)-
- (Pyridin-3-Yloxy)Acetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Pyridyloxyacetic acid, 98%
CAS:<p>3-Pyridyloxyacetic acid is used in synthesis of raw material for fine chemicals, organic intermediate, pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy</p>Formula:C7H7NO3Purity:98%Color and Shape:Powder, White to pale brownMolecular weight:153.14(Pyridin-3-yloxy)-acetic acid
CAS:Formula:C7H7NO3Purity:98%Color and Shape:SolidMolecular weight:153.13542-(Pyridine-3-yl)oxyacetic acid
CAS:<p>2-(Pyridine-3-yl)oxyacetic acid</p>Purity:98%Color and Shape:White PowderMolecular weight:153.14g/mol2-(Pyridine-3-yl)oxyacetic acid
CAS:<p>Versatile small molecule scaffold</p>Formula:C7H7NO3Purity:Min. 95%Molecular weight:153.14 g/mol




