CymitQuimica logo

CAS 86649-59-4

:

5-[(dimethylamino)methyl]furan-2-carboxylic acid

Description:
5-[(Dimethylamino)methyl]furan-2-carboxylic acid, with the CAS number 86649-59-4, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a carboxylic acid functional group (-COOH) at the 2-position of the furan ring, contributing to its acidic properties. The presence of a dimethylamino group at the 5-position enhances its basicity and solubility in polar solvents. This compound is typically a white to off-white solid and is soluble in water and organic solvents due to its polar functional groups. Its unique structure allows it to participate in various chemical reactions, making it of interest in medicinal chemistry and organic synthesis. Additionally, the dimethylamino group can influence the compound's biological activity, potentially affecting its pharmacological properties. Overall, 5-[(dimethylamino)methyl]furan-2-carboxylic acid is a versatile compound with applications in research and development within the fields of chemistry and pharmaceuticals.
Formula:C8H11NO3
InChI:InChI=1/C8H11NO3/c1-9(2)5-6-3-4-7(12-6)8(10)11/h3-4H,5H2,1-2H3,(H,10,11)
SMILES:CN(C)Cc1ccc(C(=O)O)o1
Synonyms:
  • 2-Furancarboxylic Acid, 5-[(Dimethylamino)Methyl]-
  • 5-[(Dimethylamino)Methyl]-2-Furoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.