CymitQuimica logo

CAS 866561-44-6

:

3-Amino-5-methyl-2-pyrazinemethanol

Description:
3-Amino-5-methyl-2-pyrazinemethanol is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a hydroxymethyl group (-CH2OH) attached to the pyrazine ring, contributing to its reactivity and potential applications in various chemical reactions. The presence of the methyl group enhances its hydrophobic characteristics, while the amino and hydroxymethyl groups increase its polarity, making it soluble in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which could lead to the development of new therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-Amino-5-methyl-2-pyrazinemethanol is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C6H9N3O
InChI:InChI=1S/C6H9N3O/c1-4-2-8-5(3-10)6(7)9-4/h2,10H,3H2,1H3,(H2,7,9)
InChI key:InChIKey=HCTJMRYVNPPZIS-UHFFFAOYSA-N
SMILES:C(O)C=1C(N)=NC(C)=CN1
Synonyms:
  • 2-Pyrazinemethanol, 3-amino-5-methyl-
  • 3-Amino-5-methyl-2-pyrazinemethanol
  • Pyrazinemethanol, 3-amino-5-methyl-
  • (3-Amino-5-methylpyrazin-2-yl)methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.