CAS 866607-09-2

[3-(difluoromethoxy)phenyl]boronic acid

Description:

[3-(Difluoromethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has a difluoromethoxy substituent. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications including organic synthesis and medicinal chemistry. The difluoromethoxy group enhances its electronic properties, potentially influencing its reactivity and solubility in organic solvents. The presence of fluorine atoms can also impart unique characteristics, such as increased lipophilicity and altered hydrogen bonding capabilities. In terms of stability, boronic acids are generally stable under ambient conditions but can be sensitive to moisture and air, necessitating careful handling and storage. Overall, [3-(difluoromethoxy)phenyl]boronic acid is a valuable compound in the field of synthetic chemistry, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₇H₇BF₂O₃

InChI: InChI=1/C7H7BF2O3/c9-7(10)13-6-3-1-2-5(4-6)8(11)12/h1-4,7,11-12H

SMILES: c1cc(cc(c1)OC(F)F)B(O)O

Synonyms:

• boronic acid, B-[3-(difluoromethoxy)phenyl]-
• 3-(Difluoromethoxy)benzeneboronic acid
• [3-(Difluoromethoxy)phenyl]boronic acid
• 3-(Difluoromethoxy)phenylboronic acid

(3-(Difluoromethoxy)phenyl)boronic acid

CAS: 866607-09-2

Formula: C₇H₇BF₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 187.9365

Ref: IN-DA004TDA

3-(Difluoromethoxy)benzeneboronic acid

CAS: 866607-09-2

3-(Difluoromethoxy)benzeneboronic acid

Formula: C₇H₇BF₂O₃

Purity: 97%

Color and Shape: white powder

Molecular weight: 187.94g/mol

Ref: 54-PC1596

(3-(Difluoromethoxy)phenyl)boronic acid

CAS: 866607-09-2

Purity: 97%

Molecular weight: 187.94

Ref: 10-F605512