CymitQuimica logo

CAS 866632-66-8

:

B-[4,5-Difluoro-2-(trifluoromethoxy)phenyl]boronic acid

Description:
B-[4,5-Difluoro-2-(trifluoromethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both difluoro and trifluoromethoxy groups. This compound typically exhibits properties such as high reactivity due to the boronic acid moiety, which can participate in various chemical reactions, including Suzuki coupling, a key reaction in organic synthesis. The presence of multiple fluorine atoms enhances its lipophilicity and stability, making it useful in medicinal chemistry and materials science. Additionally, the trifluoromethoxy group can influence the electronic properties of the molecule, potentially affecting its interactions in biological systems. The compound is likely to be a solid at room temperature and may have specific solubility characteristics in organic solvents. Its unique structure and functional groups make it a valuable candidate for research in drug development and the synthesis of complex organic molecules.
Formula:C7H4BF5O3
InChI:InChI=1S/C7H4BF5O3/c9-4-1-3(8(14)15)6(2-5(4)10)16-7(11,12)13/h1-2,14-15H
InChI key:InChIKey=MLOJJAQBQIXTBZ-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(B(O)O)C=C(F)C(F)=C1
Synonyms:
  • 3,4-Difluoro-6-(trifluoromethoxy)phenyl boronic acid
  • B-[4,5-Difluoro-2-(trifluoromethoxy)phenyl]boronic acid
  • Boronic acid, B-[4,5-difluoro-2-(trifluoromethoxy)phenyl]-
  • [4,5-Difluoro-2-(trifluoromethoxy)phenyl]boronic acid
  • Boronic acid, [4,5-difluoro-2-(trifluoromethoxy)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.