CAS 866683-38-7

1,2-Difluoro-4-[2-(trimethylsilyl)ethynyl]benzene

Description:

1,2-Difluoro-4-[2-(trimethylsilyl)ethynyl]benzene is an organofluorine compound characterized by the presence of two fluorine atoms and a trimethylsilyl group attached to a benzene ring. The compound features a difluorobenzene structure, which enhances its reactivity and stability due to the electronegative fluorine substituents. The trimethylsilyl group contributes to the compound's hydrophobicity and can serve as a protecting group in synthetic chemistry. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its unique electronic properties and ability to participate in various chemical reactions, such as cross-coupling reactions. Its molecular structure allows for potential applications in materials science, especially in the design of functionalized polymers or liquid crystals. As with many organofluorine compounds, it may exhibit distinct physical properties, such as altered boiling and melting points compared to its non-fluorinated analogs, making it of interest in both academic and industrial research settings.

Formula: C₁₁H₁₂F₂Si

InChI: InChI=1S/C11H12F2Si/c1-14(2,3)7-6-9-4-5-10(12)11(13)8-9/h4-5,8H,1-3H3

InChI key: InChIKey=NTYPQTJKROFKMA-UHFFFAOYSA-N

SMILES: C(#C[Si](C)(C)C)C1=CC(F)=C(F)C=C1

Synonyms:

• 2-(3,4-Difluorophenyl)-1-trimethylsilylacetylene
• Silane, [(3,4-difluorophenyl)ethynyl]trimethyl-
• 1,2-Difluoro-4-[2-(trimethylsilyl)ethynyl]benzene
• Benzene, 1,2-difluoro-4-[2-(trimethylsilyl)ethynyl]-