
CAS 866683-82-1
:2-Fluoro-5-iodo-N,N-dimethylbenzamide
Description:
2-Fluoro-5-iodo-N,N-dimethylbenzamide is an organic compound characterized by the presence of a benzamide functional group, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine (N,N-dimethyl) substituent. The compound features two halogen substituents: a fluorine atom at the 2-position and an iodine atom at the 5-position of the benzene ring, which can influence its reactivity and physical properties. The presence of these halogens typically enhances the compound's lipophilicity and may affect its biological activity. The dimethylamino group contributes to the overall basicity and solubility in polar solvents. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and synthesis of novel materials. Its molecular structure and substituents suggest that it could exhibit unique chemical behavior, making it a candidate for further research in various chemical and pharmaceutical contexts.
Formula:C9H9FINO
InChI:InChI=1S/C9H9FINO/c1-12(2)9(13)7-5-6(11)3-4-8(7)10/h3-5H,1-2H3
InChI key:InChIKey=OEEGDJHNDGQLTA-UHFFFAOYSA-N
SMILES:C(N(C)C)(=O)C1=C(F)C=CC(I)=C1
Synonyms:- 2-Fluoro-5-iodo-N,N-dimethylbenzamide
- Benzamide, 2-fluoro-5-iodo-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.