CymitQuimica logo

CAS 866721-93-9

:

3-Bromo-4-(bromomethyl)benzenemethanol

Description:
3-Bromo-4-(bromomethyl)benzenemethanol is an organic compound characterized by the presence of a benzene ring substituted with bromine and a hydroxymethyl group. The compound features two bromine atoms: one at the 3-position and another at the 4-(bromomethyl) position of the benzene ring, which enhances its reactivity and potential applications in organic synthesis. The hydroxymethyl group (-CH2OH) contributes to its solubility in polar solvents and can participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential uses in the development of pharmaceuticals or agrochemicals. Additionally, the presence of bromine atoms can influence the compound's physical properties, such as melting and boiling points, as well as its stability under different conditions. As with many brominated compounds, care should be taken regarding their environmental impact and toxicity.
Formula:C8H8Br2O
InChI:InChI=1S/C8H8Br2O/c9-4-7-2-1-6(5-11)3-8(7)10/h1-3,11H,4-5H2
InChI key:InChIKey=NNTUQEVNLSWJCD-UHFFFAOYSA-N
SMILES:C(O)C1=CC(Br)=C(CBr)C=C1
Synonyms:
  • Benzenemethanol, 3-bromo-4-(bromomethyl)-
  • 3-Bromo-4-(bromomethyl)benzenemethanol
  • [3-Bromo-4-(bromomethyl)phenyl]methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.