CAS 86674-92-2

4-(chloromethyl)-2-(4-chlorophenyl)-1,3-dioxolane

Description:

4-(Chloromethyl)-2-(4-chlorophenyl)-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which features a chloromethyl group and a para-substituted chlorophenyl group. The presence of the dioxolane moiety suggests that it may exhibit properties typical of cyclic ethers, such as being relatively stable and having moderate polarity. The chloromethyl group introduces reactivity, making it a potential electrophile in various chemical reactions, while the chlorophenyl group can influence the compound's electronic properties and solubility. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features. Additionally, the presence of chlorine atoms can enhance lipophilicity and biological activity, making it a candidate for further study in medicinal chemistry. Safety precautions should be taken when handling this compound, as halogenated organic compounds can pose health risks and environmental concerns.

Formula: C₁₀H₁₀Cl₂O₂

InChI: InChI=1/C10H10Cl2O2/c11-5-9-6-13-10(14-9)7-1-3-8(12)4-2-7/h1-4,9-10H,5-6H2

SMILES: c1cc(ccc1C1OCC(CCl)O1)Cl

4-(Chloromethyl)-2-(4-chlorophenyl)-1,3-dioxolane

CAS: 86674-92-2

Versatile small molecule scaffold

Formula: C₁₀H₁₀Cl₂O₂

Purity: Min. 95%

Molecular weight: 233.09 g/mol

Ref: 3D-LDA67492