CAS 866781-88-6

N-methyl-1-[4-(1H-pyrazol-1-yl)phenyl]methanamine

Description:

N-methyl-1-[4-(1H-pyrazol-1-yl)phenyl]methanamine, with the CAS number 866781-88-6, is an organic compound characterized by its complex structure, which includes a pyrazole ring and an amine functional group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the pyrazole moiety may impart specific biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic ring and the nitrogen atom in the pyrazole. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally. Overall, N-methyl-1-[4-(1H-pyrazol-1-yl)phenyl]methanamine represents a class of compounds that may have significant implications in pharmaceutical research and development.

Formula: C₁₁H₁₃N₃

InChI: InChI=1/C11H13N3/c1-12-9-10-3-5-11(6-4-10)14-8-2-7-13-14/h2-8,12H,9H2,1H3

SMILES: CNCc1ccc(cc1)n1cccn1

Synonyms:

• Benzenemethanamine, N-methyl-4-(1H-pyrazol-1-yl)-
• N-Methyl-1-[4-(1H-pyrazol-1-yl)phenyl]methanamine

methyl({[4-(1H-pyrazol-1-yl)phenyl]methyl})amine

CAS: 866781-88-6

Formula: C₁₁H₁₃N₃

Molecular weight: 187.2410

Ref: IN-DA008F9W

1-(4-(1h-Pyrazol-1-yl)phenyl)-N-methylmethanamine

CAS: 866781-88-6

Purity: 95+%

Molecular weight: 187.2460022

Ref: 10-F713132