CAS 866807-27-4

3-Amino-6-chloropyridine-2-carboxylic acid

Description:

3-Amino-6-chloropyridine-2-carboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the pyridine ring, along with a chlorine atom at the 6-position. The presence of these functional groups contributes to its polar nature, making it soluble in polar solvents like water. It is often used in pharmaceutical research and development due to its potential biological activity, particularly in the synthesis of various bioactive compounds. The compound's structure allows for various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in medicinal chemistry. Additionally, the chlorine substituent can influence the compound's reactivity and biological properties, making it a subject of interest in drug design. Overall, 3-Amino-6-chloropyridine-2-carboxylic acid is a versatile building block in organic synthesis and medicinal chemistry.

Formula: C₆H₅ClN₂O₂

InChI: InChI=1/C6H5ClN2O2/c7-4-2-1-3(8)5(9-4)6(10)11/h1-2H,8H2,(H,10,11)

SMILES: c1cc(Cl)nc(c1N)C(=O)O

3-Amino-6-chloro-2-pyridinecarboxylic acid

CAS: 866807-27-4

Formula: C₆H₅ClN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.5691

Ref: IN-DA0033L9

3-Amino-6-chloropyridine-2-carboxylic acid

CAS: 866807-27-4

3-Amino-6-chloropyridine-2-carboxylic acid

Formula: C₆H₅ClN₂O₂

Purity: 97%

Color and Shape: faint brown to light brown solid

Molecular weight: 172.57g/mol

Ref: 54-OR345432

3-Amino-6-chloropyridine-2-carboxylic acid

CAS: 866807-27-4

Formula: C₆H₅ClN₂O₂

Purity: 98%

Color and Shape: Yellow powder

Molecular weight: 172.57

Ref: 10-F078243