CAS 866831-75-6
:2-bromoquinoline-4-carbaldehyde
Description:
2-Bromoquinoline-4-carbaldehyde is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 2-position and an aldehyde functional group at the 4-position significantly influences its chemical reactivity and properties. This compound typically appears as a yellow to brown solid and is soluble in organic solvents such as dichloromethane and ethanol, but may have limited solubility in water. It is often used in synthetic organic chemistry as an intermediate for the preparation of various pharmaceuticals and agrochemicals. The aldehyde group allows for further functionalization, making it a versatile building block in chemical synthesis. Additionally, the bromine substituent can participate in nucleophilic substitution reactions, enhancing its utility in creating more complex molecular architectures. Safety precautions should be taken when handling this compound, as it may pose health risks due to its bromine content and potential reactivity.
Formula:C10H6BrNO
InChI:InChI=1/C10H6BrNO/c11-10-5-7(6-13)8-3-1-2-4-9(8)12-10/h1-6H
Synonyms:- 2-Bromoquinoline-4-carboxaldehyde
- 4-Quinolinecarboxaldehyde, 2-bromo-
- 2-bromoquinoline-4-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
