CAS 866837-98-1
:Ethyl 5-amino-1-(4-methylphenyl)-1H-pyrazole-3-carboxylate
Description:
Ethyl 5-amino-1-(4-methylphenyl)-1H-pyrazole-3-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the 5-amino group enhances its potential for hydrogen bonding and may influence its biological activity. The para-methylphenyl substituent at the 1-position of the pyrazole ring adds to its hydrophobic character, which can affect its interactions in biological systems. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, making it a subject of study for synthetic and analytical chemistry. Overall, Ethyl 5-amino-1-(4-methylphenyl)-1H-pyrazole-3-carboxylate represents a versatile scaffold for further chemical modifications and investigations.
Formula:C13H15N3O2
InChI:InChI=1S/C13H15N3O2/c1-3-18-13(17)11-8-12(14)16(15-11)10-6-4-9(2)5-7-10/h4-8H,3,14H2,1-2H3
InChI key:InChIKey=SMMNCFKXOKJMBP-UHFFFAOYSA-N
SMILES:NC=1N(N=C(C(OCC)=O)C1)C2=CC=C(C)C=C2
Synonyms:- Ethyl 5-amino-1-(4-methylphenyl)-1H-pyrazole-3-carboxylate
- 1H-Pyrazole-3-carboxylic acid, 5-amino-1-(4-methylphenyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
