CAS 86688-96-2
:1H-pyrrol-3-ylacetic acid
Description:
1H-Pyrrol-3-ylacetic acid, with the CAS number 86688-96-2, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features an acetic acid functional group attached to the pyrrole at the 3-position, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid group. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with various biological targets, which can be explored for therapeutic applications. Additionally, 1H-pyrrol-3-ylacetic acid can participate in various chemical reactions, including esterification and amidation, due to its functional groups. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H7NO2
InChI:InChI=1/C6H7NO2/c8-6(9)3-5-1-2-7-4-5/h1-2,4,7H,3H2,(H,8,9)
SMILES:c1c[nH]cc1CC(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(Pyrrol-3-yl)-acetic acid
CAS:Formula:C6H7NO2Purity:97%Color and Shape:SolidMolecular weight:125.12532-(1H-Pyrrol-3-yl)acetic acid
CAS:Formula:C6H7NO2Purity:95.0%Color and Shape:SolidMolecular weight:125.1272-(1H-Pyrrol-3-yl)acetic acid
CAS:<p>2-(1H-Pyrrol-3-yl)acetic acid is a thioether monosubstituted orthopedic agent that has inhibitory activities against potent inhibitory functionalities. It is a fluorine containing compound that was synthesized through electropolymerization of 2-(1H-pyrrol-3-yl)acetic acid with acrylonitrile and tetrafluoroethylene. The bioactive molecules in this compound are carboxylates, pyrrole residues, and oxidants. This molecule also has the functionalities of being an orthopedic agent, an oxidant, and a polymer film.</p>Formula:C6H7NO2Purity:Min. 95%Molecular weight:125.13 g/mol
