CAS 86696-86-8
:Tenilsetam
Description:
Tenilsetam, with the CAS number 86696-86-8, is a synthetic compound that belongs to the class of nootropic agents, which are substances purported to enhance cognitive function. It is structurally related to the racetam family of compounds, known for their potential neuroprotective and cognitive-enhancing properties. Tenilsetam is characterized by its ability to modulate neurotransmitter systems, particularly those involving acetylcholine and glutamate, which are crucial for learning and memory processes. The compound is often studied for its effects on memory enhancement and neuroprotection in various experimental models. Additionally, Tenilsetam has been noted for its relatively low toxicity profile compared to other nootropics, making it a subject of interest in both pharmacological research and potential therapeutic applications. However, comprehensive clinical data on its efficacy and safety in humans remains limited, necessitating further investigation to fully understand its pharmacodynamics and potential therapeutic benefits.
Formula:C8H10N2OS
InChI:InChI=1/C8H10N2OS/c11-8-7(9-3-4-10-8)6-2-1-5-12-6/h1-2,5,7,9H,3-4H2,(H,10,11)
SMILES:c1cc(C2C(=NCCN2)O)sc1
Synonyms:- Tenilsetam [INN]
- Cas 997
- Tenilsetamum
- Tenilsetamum [Latin]
- Unii-O4Q7Xm74N6
- (+-)-3-(2-Thienyl)-2-piperazinone
- Piperazinone, 3-(2-thienyl)-
- 3-(Thiophen-2-Yl)Piperazin-2-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Tenilsetam
CAS:Tenilsetam: an endonuclease, nootropic, AGE inhibitor potential for Alzheimer's.Formula:C8H10N2OSPurity:99.52%Color and Shape:SolidMolecular weight:182.24Ref: TM-T8583
1mg58.00€5mg116.00€10mg172.00€25mg281.00€50mg396.00€100mg537.00€200mg712.00€1mL*10mM (DMSO)96.00€3-(Thiophen-2-yl)piperazin-2-one
CAS:3-(Thiophen-2-yl)piperazin-2-one (TPZ) is a chemical compound with a molecular weight of 248.37 g/mol. TPZ has been shown to inhibit the mitochondrial membrane potential, which leads to the release of cytochrome c and ATP production inhibition in microglia cells. TPZ is also an acetylcholine receptor agonist that binds to the α7 nicotinic acetylcholine receptor. TPZ has been shown to have dose-dependent effects on diabetic patients, suggesting its clinical relevance for metabolic disorders like diabetes mellitus type 2 and obesity. TPZ may be used as an inhibitor in fatty acid synthesis, although it is not a specific enzyme inhibitor for any particular enzyme.Formula:C8H10N2OSPurity:Min. 95%Molecular weight:182.25 g/mol



