CAS 867-36-7
:Dipropyltin dichloride
Description:
Dipropyltin dichloride, with the CAS number 867-36-7, is an organotin compound characterized by its tin atom bonded to two propyl groups and two chlorine atoms. It typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. This compound is known for its applications as a biocide and a stabilizer in PVC formulations, owing to its ability to inhibit microbial growth and enhance material durability. Dipropyltin dichloride exhibits moderate toxicity, necessitating careful handling and appropriate safety measures during use. It is soluble in organic solvents but has limited solubility in water, which influences its environmental behavior and potential bioaccumulation. The compound can undergo hydrolysis in the presence of moisture, leading to the formation of less toxic byproducts. Additionally, dipropyltin dichloride is subject to regulatory scrutiny due to its potential environmental and health impacts, particularly concerning its endocrine-disrupting properties. Overall, its unique chemical structure and properties make it significant in various industrial applications while also raising concerns regarding safety and environmental sustainability.
Formula:C6H14Cl2Sn
InChI:InChI=1S/2C3H7.2ClH.Sn/c2*1-3-2;;;/h2*1,3H2,2H3;2*1H;/q;;;;+2/p-2
InChI key:InChIKey=CTRHCENQKGMZLE-UHFFFAOYSA-L
SMILES:[Sn](CCC)(CCC)(Cl)Cl
Synonyms:- Dipropyltin chloride
- Dipropyltin dichloride
- Tin, dichlorodipropyl-
- Stannane, dichlorodipropyl-
- Dichlorodipropylstannane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Dichlorodipropylstannane
CAS:Formula:C6H14Cl2SnPurity:97%Color and Shape:SolidMolecular weight:275.7824Di-n-propyltin dichloride 1000 µg/mL in Methanol
CAS:Controlled ProductFormula:C6H14Cl2SnColor and Shape:Single SolutionMolecular weight:275.79Di-n-propyltin dichloride 10 µg/mL in Isooctane
CAS:Formula:C6H14Cl2SnColor and Shape:Single SolutionMolecular weight:275.79Dichlorodipropyltin
CAS:Applications Dichlorodipropyltin is a diorganotin dihalide which has broad applications in both laboratory and industry. The Dichlorodipropyltin class of compounds can be used as a poly(vinyl chloride) stabilizers, fungicides and insecticides.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Chandrasekaran, R.K. et al.: J. Organometallic Chem. 3, 215 (1981);Formula:C6H14Cl2SnColor and Shape:WhiteMolecular weight:275.79


