
CAS 867-54-9
:1,1-Dibromoacetone
Description:
1,1-Dibromoacetone is an organic compound characterized by its structure, which features two bromine atoms attached to the first carbon of the acetone backbone. Its molecular formula is C3H4Br2O, indicating the presence of three carbon atoms, four hydrogen atoms, two bromine atoms, and one oxygen atom. This compound is typically a colorless to pale yellow liquid with a sweet, somewhat pungent odor. It is known for its reactivity, particularly due to the presence of the bromine atoms, which can participate in various chemical reactions, including nucleophilic substitutions. 1,1-Dibromoacetone is soluble in organic solvents but has limited solubility in water. It is used in organic synthesis and as an intermediate in the production of other chemical compounds. Safety precautions are necessary when handling this substance, as it can be harmful if inhaled or absorbed through the skin, and it may pose environmental hazards. Proper storage and disposal methods should be followed to mitigate any risks associated with its use.
Formula:C3H4Br2O
InChI:InChI=1S/C3H4Br2O/c1-2(6)3(4)5/h3H,1H3
InChI key:InChIKey=ZABBFAHZPHMIJC-UHFFFAOYSA-N
SMILES:C(C(C)=O)(Br)Br
Synonyms:- Dibromomethyl methyl ketone
- 1,1-Dibromoacetone
- 1,1-Dibromo-2-propanone
- 2-Propanone, 1,1-dibromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,1-Dibromoacetone
CAS:1,1-Dibromoacetone is a dibromide product based on bromoacetone.Formula:C3H4Br2OColor and Shape:SolidMolecular weight:215.87
