CAS 867-84-5

Fluoroalaninehydrochloride; 99%

Description:

Fluoroalanine hydrochloride, with the CAS number 867-84-5, is an amino acid derivative characterized by the presence of a fluorine atom in its structure, specifically at the alpha position relative to the amino group. This compound is typically a white crystalline solid that is soluble in water and exhibits properties similar to those of standard amino acids. The presence of the fluorine atom can influence its biological activity and interactions, making it of interest in various fields, including medicinal chemistry and biochemistry. Fluoroalanine hydrochloride is often used in research settings, particularly in studies related to protein synthesis and enzyme activity, as it can serve as a building block for the incorporation of fluorinated amino acids into peptides and proteins. Its hydrochloride form indicates that it is a salt, which enhances its stability and solubility in aqueous solutions. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and reactivity.

Formula: C₃H₇ClFNO₂

InChI: InChI=1/C3H6FNO2.ClH/c4-2(1-5)3(6)7;/h2H,1,5H2,(H,6,7);1H

SMILES: C(C(C(=O)O)F)N.Cl

Synonyms:

• 2-Fluoro--alanine hydrochloride

2-Fluoro-β-alanine Hydrochloride

CAS: 867-84-5

Formula: C₃H₆FNO₂·HCl

Purity: >99.0%(N)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 143.54

Ref: 3B-F0185

2-Fluoro-β-alanine HCl

CAS: 867-84-5

Formula: C₃H₇ClFNO₂

Purity: 99%

Color and Shape: Solid

Molecular weight: 143.5446

Ref: IN-DA003HBP

3-Amino-2-fluoro-propanoic Acid Hydrochloride

Controlled Product

CAS: 867-84-5

Applications 3-Amino-2-fluoro-propanoic acid is an analogue of the anti-cancer drug 5-Flurouracil.
References Gani, D., et al.: J. Chem. Soc. Perkin Trans., 1363 (1985)

Formula: C₃H₇ClFNO₂

Color and Shape: Neat

Molecular weight: 143.54

Ref: TR-F587355