CAS 867006-12-0
:2-benzyl-2,9-diazaspiro[5.5]undecane-8,10-dione
Description:
2-benzyl-2,9-diazaspiro[5.5]undecane-8,10-dione is a complex organic compound characterized by its unique spirocyclic structure, which features a bicyclic framework containing nitrogen atoms. This compound includes a benzyl group, contributing to its aromatic characteristics and potential for various chemical interactions. The presence of two carbonyl (dione) functional groups enhances its reactivity, making it a candidate for various synthetic applications, including medicinal chemistry and material science. The diazaspiro structure indicates that it contains two nitrogen atoms within the spiro framework, which can influence its biological activity and solubility properties. Additionally, the compound's molecular geometry and electronic properties may allow for interesting interactions with biological targets, potentially leading to pharmacological applications. Overall, 2-benzyl-2,9-diazaspiro[5.5]undecane-8,10-dione represents a fascinating subject for further research in organic synthesis and drug development due to its structural complexity and functional versatility.
Formula:C16H20N2O2
InChI:InChI=1/C16H20N2O2/c19-14-9-16(10-15(20)17-14)7-4-8-18(12-16)11-13-5-2-1-3-6-13/h1-3,5-6H,4,7-12H2,(H,17,19,20)
Synonyms:- 2-Benzyl-2,9-diazaspiro[5.5]undecan-8,10-dion
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.