CAS 867006-13-1

2-benzyl-2,9-diazaspiro[5.5]undecane

Description:

2-benzyl-2,9-diazaspiro[5.5]undecane is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework featuring two nitrogen atoms incorporated into the spiro system. This compound typically exhibits a complex three-dimensional arrangement, contributing to its potential biological activity and interaction with various receptors. The presence of the benzyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Additionally, the diazaspiro structure can impart distinctive chemical reactivity and stability, making it of interest in medicinal chemistry and drug design. The compound may also exhibit specific stereochemical properties, which can affect its pharmacological profile. As with many nitrogen-containing heterocycles, it may participate in hydrogen bonding and other intermolecular interactions, further influencing its behavior in different environments. Overall, 2-benzyl-2,9-diazaspiro[5.5]undecane represents a fascinating subject for research, particularly in the fields of organic synthesis and pharmacology.

Formula: C₁₆H₂₄N₂

InChI: InChI=1/C16H24N2/c1-2-5-15(6-3-1)13-18-12-4-7-16(14-18)8-10-17-11-9-16/h1-3,5-6,17H,4,7-14H2

SMILES: c1ccc(cc1)CN1CCCC2(CCNCC2)C1

Synonyms:

• 2-Benzyl-2,9-diazaspiro[5.5]undecan

2-Benzyl-2,9-diazaspiro[5.5]undecane 2hcl

CAS: 867006-13-1

Formula: C₁₆H₂₆Cl₂N₂

Molecular weight: 317.2970

Ref: IN-DA00IE6P

2-Benzyl-2,9-diazaspiro[5.5]undecane

CAS: 867006-13-1

2-Benzyl-2,9-diazaspiro[5.5]undecane

Purity: ≥95%

Molecular weight: 244.38g/mol

Ref: 54-OR470848