CAS 867007-99-6

6-Methyl-2-pyrazinemethanamine

Description:

6-Methyl-2-pyrazinemethanamine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a methyl group at the 6-position and an amine functional group, contributing to its reactivity and potential applications in various chemical processes. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group. The compound's unique structure allows it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. It may also serve as a building block in the synthesis of more complex molecules, particularly in pharmaceutical chemistry. As with many nitrogen-containing heterocycles, it could exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper safety protocols are followed.

Formula: C₆H₉N₃

InChI: InChI=1S/C6H9N3/c1-5-3-8-4-6(2-7)9-5/h3-4H,2,7H2,1H3

InChI key: InChIKey=ZNOZUQRBTVMBQF-UHFFFAOYSA-N

SMILES: C(N)C1=NC(C)=CN=C1

Synonyms:

• Pyrazinemethanamine, 6-methyl-
• 2-Pyrazinemethanamine, 6-methyl-
• C-(6-Methylpyrazin-2-yl)methylamine
• (6-Methylpyrazin-2-yl)methanamine
• 6-Methyl-2-pyrazinemethanamine