CymitQuimica logo

CAS 867162-39-8

:

2-[(3-Chloro-2-pyrazinyl)(2-phenyl-7-quinolinyl)methyl]-1H-isoindole-1,3(2H)-dione

Description:
The chemical substance known as 2-[(3-Chloro-2-pyrazinyl)(2-phenyl-7-quinolinyl)methyl]-1H-isoindole-1,3(2H)-dione, with the CAS number 867162-39-8, is a complex organic compound characterized by its unique structural features. It contains an isoindole core, which is a bicyclic structure that contributes to its stability and reactivity. The presence of a chloro group and a pyrazine ring introduces halogen and nitrogen functionalities, enhancing its potential for biological activity. Additionally, the compound features a quinoline moiety, known for its pharmacological properties, which may suggest potential applications in medicinal chemistry. The overall molecular structure indicates that it may exhibit interesting interactions with biological targets, making it a candidate for further investigation in drug development. Its solubility, stability, and reactivity would depend on the specific conditions, including solvent and pH, which are crucial for understanding its behavior in various chemical environments.
Formula:C28H17ClN4O2
InChI:InChI=1S/C28H17ClN4O2/c29-26-24(30-14-15-31-26)25(33-27(34)20-8-4-5-9-21(20)28(33)35)19-11-10-18-12-13-22(32-23(18)16-19)17-6-2-1-3-7-17/h1-16,25H
InChI key:InChIKey=NJURFYFVLMVDIE-UHFFFAOYSA-N
SMILES:C(N1C(=O)C=2C(C1=O)=CC=CC2)(C3=CC4=C(C=C3)C=CC(=N4)C5=CC=CC=C5)C=6C(Cl)=NC=CN6
Synonyms:
  • 1H-Isoindole-1,3(2H)-dione, 2-[(3-chloro-2-pyrazinyl)(2-phenyl-7-quinolinyl)methyl]-
  • 1H-Isoindole-1,3(2H)-dione, 2-[(3-chloropyrazinyl)(2-phenyl-7-quinolinyl)methyl]-
  • 2-[(3-chloropyrazin-2-yl)(2-phenylquinolin-7-yl)methyl]isoindole-1,3-dione
  • 2-((3-Chloropyrazin-2-yl)(2-phenylquinolin-7-yl)methyl)isoindoline-1,3-dione
  • 2-[(3-Chloro-2-pyrazinyl)(2-phenyl-7-quinolinyl)methyl]-1H-isoindole-1,3(2H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.