CymitQuimica logo

CAS 867165-53-5

:

3-Chloropyrazin-2-methanamine dihydrochloride

Description:
3-Chloropyrazin-2-methanamine dihydrochloride is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a methanamine group at the 2-position contributes to its unique reactivity and potential biological activity. As a dihydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical research. The compound may exhibit properties such as antimicrobial or antitumor activity, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, which can be explored in drug development. Safety data and handling precautions should be considered, as with any chemical substance, particularly regarding its potential toxicity and environmental impact. Overall, 3-Chloropyrazin-2-methanamine dihydrochloride represents a significant compound for further investigation in chemical and biological studies.
Formula:C5H6ClN3(HCl)
InChI:InChI=1S/C5H6ClN3.2ClH/c6-5-4(3-7)8-1-2-9-5;;/h1-2H,3,7H2;2*1H
InChI key:RHKWGVWUXBFIIE-UHFFFAOYSA-N
SMILES:C1=CN=C(C(=N1)CN)Cl.Cl.Cl
Synonyms:
  • (3-Chloropyrazin-2-Yl)Methanamine Dihydrochloride
Found 4 products.