CAS 867165-55-7

2-[(3-Chloro-2-pyrazinyl)methyl]-1H-isoindole-1,3(2H)-dione

Description:

2-[(3-Chloro-2-pyrazinyl)methyl]-1H-isoindole-1,3(2H)-dione, identified by its CAS number 867165-55-7, is a chemical compound characterized by its complex structure that includes an isoindole core and a pyrazine moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the pyrazine and isoindole rings. It may display moderate to high solubility in organic solvents, depending on the specific substituents and their electronic effects. The chloro substituent can influence its reactivity and interaction with biological targets. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR, mass spectrometry, and IR spectroscopy to confirm its structure and purity. Overall, this compound represents a class of molecules that could have significant applications in various fields, including drug discovery and material science.

Formula: C₁₃H₈ClN₃O₂

InChI: InChI=1S/C13H8ClN3O2/c14-11-10(15-5-6-16-11)7-17-12(18)8-3-1-2-4-9(8)13(17)19/h1-6H,7H2

InChI key: InChIKey=WTNASFUELNZJJX-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)N1CC=3C(Cl)=NC=CN3)=CC=CC2

Synonyms:

• 2-[(3-Chloro-2-pyrazinyl)methyl]-1H-isoindole-1,3(2H)-dione
• 1H-Isoindole-1,3(2H)-dione, 2-[(3-chloro-2-pyrazinyl)methyl]-
• 2-[(3-Chloropyrazin-2-yl)methyl]isoindole-1,3-dione
• 2-((3-Chloropyrazin-2-yl)methyl)isoindoline-1,3-dione
• 1H-Isoindole-1,3(2H)-dione, 2-[(3-chloropyrazinyl)methyl]-