CymitQuimica logo

CAS 867166-73-2

:

1-(4-nitrophenyl)piperazin-2-one

Description:
1-(4-Nitrophenyl)piperazin-2-one is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a nitrophenyl group at the 1-position of the piperazine ring contributes to its unique properties, including potential biological activity. This compound typically exhibits a solid state at room temperature and is soluble in various organic solvents, which is common for piperazine derivatives. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and interaction with biological targets. Additionally, 1-(4-nitrophenyl)piperazin-2-one may exhibit pharmacological properties, making it of interest in medicinal chemistry for the development of therapeutic agents. Its molecular structure allows for potential interactions with neurotransmitter systems, which could be relevant in the context of neuropharmacology. As with many chemical substances, safety and handling precautions should be observed, given the potential toxicity associated with nitro compounds.
Formula:C10H11N3O3
InChI:InChI=1S/C10H11N3O3/c14-10-7-11-5-6-12(10)8-1-3-9(4-2-8)13(15)16/h1-4,11H,5-7H2
InChI key:TXHGONHNTRRRNA-UHFFFAOYSA-N
SMILES:C1CN(C(=O)CN1)C2=CC=C(C=C2)[N+](=O)[O-]
Found 3 products.