CAS 867178-11-8

3-Hydroxy-1-cyclopentene-1-carboxylic acid

Description:

3-Hydroxy-1-cyclopentene-1-carboxylic acid is an organic compound characterized by its cyclopentene structure, which features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to the cyclopentene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It exhibits both acidic and alcohol functionalities, making it a versatile intermediate in organic synthesis. The presence of the hydroxyl group contributes to its potential for hydrogen bonding, influencing its solubility in polar solvents like water. Additionally, the carboxylic acid group can participate in various chemical reactions, including esterification and amidation. The compound's unique structure may also impart specific reactivity patterns, making it of interest in medicinal chemistry and materials science. As with many organic compounds, handling should be done with care, considering potential hazards and reactivity. Overall, 3-Hydroxy-1-cyclopentene-1-carboxylic acid is a valuable compound in the realm of organic chemistry.

Formula: C₆H₈O₃

InChI: InChI=1S/C6H8O3/c7-5-2-1-4(3-5)6(8)9/h3,5,7H,1-2H2,(H,8,9)

InChI key: InChIKey=VKJGQKRRULDFCI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(O)CC1

Synonyms:

• 1-Cyclopentene-1-carboxylic acid, 3-hydroxy-
• 3-Hydroxy-1-cyclopentene-1-carboxylic acid

HOCPCA

CAS: 867178-11-8

HOCPCA: potent, selective GHB site ligand; 27x higher affinity than GHB; crosses blood-brain barrier.

Formula: C₆H₈O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 128.13

Ref: TM-T24146