CAS 86722-66-9
:1-[(2-Hydroxyethyl)amino]-4-(methylamino)-9,10-anthracenedione
Description:
1-[(2-Hydroxyethyl)amino]-4-(methylamino)-9,10-anthracenedione, with the CAS number 86722-66-9, is a synthetic organic compound characterized by its anthraquinone structure, which features a fused ring system that contributes to its stability and potential for various applications. This compound contains functional groups such as amino and hydroxyethyl, which enhance its solubility and reactivity. It typically exhibits a deep color, characteristic of many anthraquinone derivatives, and may display fluorescence properties. The presence of the amino groups suggests potential for biological activity, making it of interest in fields such as medicinal chemistry and dye production. Its solubility in organic solvents and moderate solubility in water can facilitate its use in various formulations. Additionally, the compound's stability under standard conditions allows for its application in research and industrial processes. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or environmental impact.
Formula:C17H16N2O3
InChI:InChI=1S/C17H16N2O3/c1-18-12-6-7-13(19-8-9-20)15-14(12)16(21)10-4-2-3-5-11(10)17(15)22/h2-7,18-20H,8-9H2,1H3
InChI key:InChIKey=NLXFWUZKOOWWFD-UHFFFAOYSA-N
SMILES:N(CCO)C1=C2C(C(=O)C=3C(C2=O)=CC=CC3)=C(NC)C=C1
Synonyms:- 1-(2-Hydroxyethylamino)-4-(methylamino)anthraquinone
- 1-(beta-Hydroxyethylamino)-4-(methylamino)anthraquinone
- 1-[(2-Hydroxyethyl)amino]-4-(methylamino)-9,10-anthracenedione
- 9,10-Anthracenedione, 1-((2-hydroxyethyl)amino)-4-(methylamino)-
- Anthraquinone, 1-((2-hydroxyethyl)amino)-4-(methylamino)- (8CI)
- Anthraquinone, 1-[(2-hydroxyethyl)amino]-4-(methylamino)-
- Nsc 64753
- Serisol Brilliant Blue BGN 300
- Toray blue
- 1-((2-Hydroxyethyl)amino)-4-(methylamino)anthraquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Disperse Blue 3
CAS:Controlled Product<p>Applications Nonoxidative coloring agent for semipermanent coloring of keratin fibers such as hair and wool.<br>References Chen, C., et al.: Science, 279, 851 (1998), Nitz, M., et al.: Chembiochem., 4, 272 (2003),<br></p>Formula:C17H16N2O3Color and Shape:NeatMolecular weight:296.32
