CAS 86724-79-0

3-Pyridinecarbonitrile, 2-amino-6-fluoro-

Description:

3-Pyridinecarbonitrile, 2-amino-6-fluoro- is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a cyano group (-C≡N) attached to the carbon atom of the pyridine ring, as well as an amino group (-NH2) and a fluorine atom at specific positions, contributing to its unique reactivity and properties. The presence of the amino group makes it a potential candidate for various chemical reactions, including nucleophilic substitutions. The fluorine atom can influence the compound's polarity and solubility, affecting its behavior in biological systems and chemical processes. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Its CAS number, 86724-79-0, allows for easy identification and reference in chemical databases and literature. Overall, 3-Pyridinecarbonitrile, 2-amino-6-fluoro- exhibits characteristics typical of heterocyclic compounds, with specific functional groups that enhance its chemical versatility.

Formula: C₆H₄FN₃

InChI: InChI=1S/C6H4FN3/c7-5-2-1-4(3-8)6(9)10-5/h1-2H,(H2,9,10)

InChI key: InChIKey=KZPMOZCQPOMBJG-UHFFFAOYSA-N

SMILES: C(#N)C1=C(N)N=C(F)C=C1

Synonyms:

• 2-Amino-6-fluoropyridine-3-carbonitrile
• 3-Pyridinecarbonitrile, 2-amino-6-fluoro-