
CAS 867267-26-3
:2,5-Dimethoxy-3-pyridinecarboxaldehyde
Description:
2,5-Dimethoxy-3-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features two methoxy groups (-OCH3) attached to the 2 and 5 positions of the pyridine ring, enhancing its solubility in organic solvents and influencing its reactivity. The presence of the aldehyde functional group (-CHO) at the 3-position contributes to its potential as a reactive intermediate in organic synthesis. This compound is typically a pale yellow to light brown liquid or solid, depending on its purity and form. It is known for its applications in the synthesis of various pharmaceuticals and agrochemicals, as well as in research settings for studying pyridine derivatives. The methoxy groups can also affect the electronic properties of the molecule, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H9NO3
InChI:InChI=1S/C8H9NO3/c1-11-7-3-6(5-10)8(12-2)9-4-7/h3-5H,1-2H3
InChI key:InChIKey=RYPWBUNUTMJPHA-UHFFFAOYSA-N
SMILES:C(=O)C1=C(OC)N=CC(OC)=C1
Synonyms:- 3-Pyridinecarboxaldehyde, 2,5-dimethoxy-
- 2,5-Dimethoxynicotinaldehyde
- 2,5-Dimethoxy-pyridine-3-carbaldehyde
- 2,5-Dimethoxy-3-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.