CAS 86727-00-6
:(2Z)-5-bromo-5-methyl-3-phenyl-2-(phenylimino)-1,3-thiazinan-4-one
Description:
(2Z)-5-bromo-5-methyl-3-phenyl-2-(phenylimino)-1,3-thiazinan-4-one is a heterocyclic compound characterized by its thiazine ring structure, which incorporates sulfur and nitrogen atoms. This compound features a bromine atom and a methyl group at the 5-position, along with a phenyl group at the 3-position, contributing to its aromatic properties. The presence of a phenylimino group at the 2-position enhances its reactivity and potential for forming various derivatives. The thiazine ring is known for its biological activity, making such compounds of interest in medicinal chemistry. The compound's structure suggests it may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would require empirical investigation. Its CAS number, 86727-00-6, allows for easy identification in chemical databases. Overall, this compound exemplifies the complexity and diversity of heterocyclic chemistry, with potential applications in pharmaceuticals and organic synthesis.
Formula:C17H15BrN2OS
InChI:InChI=1/C17H15BrN2OS/c1-17(18)12-22-16(19-13-8-4-2-5-9-13)20(15(17)21)14-10-6-3-7-11-14/h2-11H,12H2,1H3/b19-16-
Synonyms:- 4H-1,3-Thiazin-4-one, 5-bromotetrahydro-5-methyl-3-phenyl-2-(phenylimino)-
- 5-Bromotetrahydro-5-methyl-3-phenyl-2-(phenylimino)-4H-1,3-thiazin-4-one
- CK 17
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CK 17
CAS:CK-17 is an interleukin-1 antagonist and an IL-1 blocker, which inhibits fibroblast proliferation in a concentration-dependent manner.Formula:C17H15BrN2OSColor and Shape:SolidMolecular weight:375.28
