
CAS 867296-29-5
:2-Propenoic acid, 2-methyl-, 3-hydroxytricyclo[3.3.1.13,7]dec-1-yl ester, homopolymer
Description:
The chemical substance known as "2-Propenoic acid, 2-methyl-, 3-hydroxytricyclo[3.3.1.13,7]dec-1-yl ester, homopolymer" with CAS number 867296-29-5 is a polymer derived from the polymerization of a specific monomer that contains a tricyclic structure. This compound features a methacrylic acid derivative, which contributes to its reactivity and ability to form cross-linked networks. The presence of hydroxyl groups in its structure enhances its potential for hydrogen bonding, affecting its solubility and thermal properties. The tricyclic framework provides rigidity, which can influence the mechanical strength and stability of the polymer. Typically, such polymers exhibit good adhesion properties, making them suitable for applications in coatings, adhesives, and sealants. Additionally, the unique structural characteristics may impart specific functionalities, such as biocompatibility or responsiveness to environmental stimuli, depending on the intended application. Overall, this polymer represents a specialized class of materials with diverse potential uses in various industrial and research fields.
Formula:(C14H20O3)x
InChI:InChI=1S/C14H20O3/c1-9(2)12(15)17-14-6-10-3-11(7-14)5-13(16,4-10)8-14/h10-11,16H,1,3-8H2,2H3
InChI key:InChIKey=OOIBFPKQHULHSQ-UHFFFAOYSA-N
SMILES:O(C(C(C)=C)=O)C12CC3(O)CC(C1)CC(C2)C3
Synonyms:- 3-Hydroxy-1-adamantyl methacrylate homopolymer
- 1,3-Adamantyldiol monomethacrylate homopolymer
- 2-Propenoic acid, 2-methyl-, 3-hydroxytricyclo[3.3.1.13,7]dec-1-yl ester, homopolymer
- Poly(3-hydroxy-1-adamantyl methacrylate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propenoic acid, 2-methyl-, 3-hydroxytricyclo[3.3.1.13,7]dec-1-yl ester, homopolymer
CAS:Formula:C14H20O3Molecular weight:236.3068
