CAS 867333-29-7
:(2-chloro-5-nitro-phenyl)boronic acid
Description:
(2-Chloro-5-nitro-phenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both a chlorine atom and a nitro group. This compound typically appears as a solid and is soluble in polar organic solvents. Its structure features a boron atom bonded to a hydroxyl group and an aromatic ring, which enhances its reactivity in various chemical reactions, particularly in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. The presence of the nitro group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and stability. Additionally, the chlorine substituent can participate in further substitution reactions. Due to its unique functional groups, (2-chloro-5-nitro-phenyl)boronic acid is of interest in medicinal chemistry and materials science, where it may serve as a building block for more complex molecules or as a reagent in the development of pharmaceuticals.
Formula:C6H5BClNO4
InChI:InChI=1/C6H5BClNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3,10-11H
SMILES:c1cc(c(cc1N(=O)=O)B(O)O)Cl
Synonyms:- (2-Chloro-5-nitrophenyl)boronic acid
- boronic acid, B-(2-chloro-5-nitrophenyl)-
- 2-Chloro-5-nitrophenylboronicacid
- 2-Chloro-5-nitrophenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-5-nitrophenylboronic acid
CAS:Formula:C6H5BClNO4Purity:97%Color and Shape:SolidMolecular weight:201.37222-Chloro-5-nitrobenzeneboronic acid
CAS:<p>2-Chloro-5-nitrobenzeneboronic acid</p>Purity:94%Color and Shape:White SolidMolecular weight:201.37g/mol2-Chloro-5-nitrophenylboronic acid
CAS:Formula:C6H5BClNO4Purity:95%Color and Shape:SolidMolecular weight:201.37(2-Chloro-5-nitrophenyl)boronic acid
CAS:Please enquire for more information about (2-Chloro-5-nitrophenyl)boronic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C6H5BClNO4Purity:Min. 95%Molecular weight:201.37 g/mol




