CymitQuimica logo

CAS 867333-31-1

:

7-(2,6-Dichlorophenyl)-5-methyl-1,2,4-benzotriazin-3-amine

Description:
7-(2,6-Dichlorophenyl)-5-methyl-1,2,4-benzotriazin-3-amine is a chemical compound characterized by its complex structure, which includes a benzotriazine core substituted with a dichlorophenyl group and a methyl group. This compound typically exhibits properties associated with aromatic amines, such as potential biological activity and the ability to participate in various chemical reactions due to the presence of the amine functional group. The dichlorophenyl substituent may influence its lipophilicity and reactivity, potentially enhancing its interaction with biological targets. The compound's structure suggests it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, its stability and solubility characteristics would be important for its application in various fields. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine atoms, which can impart toxicity or environmental concerns. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C14H10Cl2N4
InChI:InChI=1S/C14H10Cl2N4/c1-7-5-8(12-9(15)3-2-4-10(12)16)6-11-13(7)18-14(17)20-19-11/h2-6H,1H3,(H2,17,18,20)
InChI key:InChIKey=VIPXIJIKXLCFJS-UHFFFAOYSA-N
SMILES:ClC1=C(C(Cl)=CC=C1)C2=CC3=C(C(C)=C2)N=C(N)N=N3
Synonyms:
  • 1,2,4-Benzotriazin-3-amine, 7-(2,6-dichlorophenyl)-5-methyl-
  • 7-(2,6-Dichlorophenyl)-5-methyl-1,2,4-benzotriazin-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.