CAS 867333-38-8
:7-bromo-6-methyl-1,2,4-benzotriazin-3-amine
Description:
7-Bromo-6-methyl-1,2,4-benzotriazin-3-amine is a chemical compound characterized by its unique structure, which includes a benzotriazine core substituted with a bromine atom and a methyl group. This compound typically exhibits properties associated with aromatic amines, such as potential reactivity in electrophilic substitution reactions due to the presence of the amino group. The bromine substituent can enhance the compound's reactivity and influence its solubility in various solvents. Additionally, the presence of the methyl group may affect the steric hindrance and electronic properties of the molecule. As a benzotriazine derivative, it may also exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. The compound's CAS number, 867333-38-8, allows for easy identification and retrieval of information in chemical databases. Overall, 7-bromo-6-methyl-1,2,4-benzotriazin-3-amine is a notable compound with potential applications in research and development, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C8H7BrN4
InChI:InChI=1/C8H7BrN4/c1-4-2-6-7(3-5(4)9)12-13-8(10)11-6/h2-3H,1H3,(H2,10,11,13)
Synonyms:- 7-Bromo-6-methyl-1,2,4-benzotriazin-3-amine
- 1,2,4-Benzotriazin-3-amine, 7-bromo-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
