CAS 867333-39-9
:2-[[(4-Bromophenyl)methyl](1-methylethyl)amino]ethanol
Description:
2-[[(4-Bromophenyl)methyl](1-methylethyl)amino]ethanol, identified by its CAS number 867333-39-9, is a chemical compound characterized by its complex structure, which includes a brominated phenyl group, an isopropyl group, and an ethanol moiety. This compound features a secondary amine, where the nitrogen atom is bonded to both an isopropyl group and a benzyl group that contains a bromine substituent. The presence of the bromine atom enhances its reactivity and may influence its biological activity. The hydroxyl group in the ethanol part of the molecule contributes to its potential solubility in polar solvents and may also play a role in hydrogen bonding interactions. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific pharmacological properties. However, detailed studies would be necessary to fully understand its behavior, including its stability, reactivity, and potential applications in various fields such as pharmaceuticals or materials science.
Formula:C12H18BrNO
InChI:InChI=1S/C12H18BrNO/c1-10(2)14(7-8-15)9-11-3-5-12(13)6-4-11/h3-6,10,15H,7-9H2,1-2H3
InChI key:InChIKey=IGMDWDJDPQOQPW-UHFFFAOYSA-N
SMILES:C(N(CCO)C(C)C)C1=CC=C(Br)C=C1
Synonyms:- Ethanol, 2-[[(4-bromophenyl)methyl](1-methylethyl)amino]-
- 2-[[(4-Bromophenyl)methyl](1-methylethyl)amino]ethanol
- 2-[(4-Bromo-benzyl)-isopropyl-amino]-ethanol
- 2-[[(4-Bromophenyl)methyl](propan-2-yl)amino]ethan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.