CAS 867382-45-4

3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid

Description:

3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid, commonly referred to as Fmoc-Asp(β-Butyric acid)-OH, is a chemical compound characterized by its structure, which includes a fluorenylmethoxycarbonyl (Fmoc) protecting group attached to an amino acid derivative. This compound features a butanoic acid side chain, which contributes to its amphiphilic nature, making it soluble in both polar and non-polar solvents. The Fmoc group is widely used in peptide synthesis as a protective group for amino acids, allowing for selective reactions during the synthesis process. The presence of the aromatic ring enhances its stability and provides unique electronic properties. Additionally, the compound is typically utilized in the field of biochemistry and medicinal chemistry for the synthesis of peptides and proteins, where it plays a crucial role in facilitating the formation of peptide bonds. Its CAS number, 867382-45-4, allows for easy identification and reference in chemical databases and literature. Overall, this compound is significant in synthetic organic chemistry and peptide research.

Formula: C₂₅H₂₃NO₄

InChI: InChI=1S/C25H23NO4/c27-24(28)14-6-8-17-7-5-9-18(15-17)26-25(29)30-16-23-21-12-3-1-10-19(21)20-11-2-4-13-22(20)23/h1-5,7,9-13,15,23H,6,8,14,16H2,(H,26,29)(H,27,28)

InChI key: InChIKey=YERMDNRHJNZMJT-UHFFFAOYSA-N

SMILES: C(OC(NC1=CC(CCCC(O)=O)=CC=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• 3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid
• Benzenebutanoic acid, 3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-
• 4-(3-((((9h-Fluoren-9-yl)methoxy)carbonyl)amino)phenyl)butanoic acid
• Fmoc-4-(3-aminophenyl)butanoic acid