CymitQuimica logo

CAS 86761-38-8

:

triphosphoric acid, mono[2-[(2-amino-3,6-dihydro-6-oxo-9H-purin-9-yl)methoxy]-3-hydroxypropyl] ester

Description:
Triphosphoric acid, mono[2-[(2-amino-3,6-dihydro-6-oxo-9H-purin-9-yl)methoxy]-3-hydroxypropyl] ester, identified by CAS number 86761-38-8, is a complex organic compound that features a triphosphoric acid backbone modified with a specific ester group. This compound is characterized by its structural components, which include a purine derivative, contributing to its potential biological activity. The presence of the amino and hydroxy groups suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. The methoxy and hydroxypropyl substituents enhance its potential for interaction with biological molecules, possibly indicating a role in biochemical pathways or as a pharmaceutical agent. Additionally, the triphosphoric acid moiety may impart properties related to energy transfer or signaling in biological systems. Overall, this compound's unique structure suggests it could have applications in biochemistry or medicinal chemistry, although specific functional properties would require further investigation through empirical studies.
Formula:C9H16N5O13P3
InChI:InChI=1/C9H16N5O13P3/c10-9-12-7-6(8(16)13-9)11-3-14(7)4-24-5(1-15)2-25-29(20,21)27-30(22,23)26-28(17,18)19/h3,5,15H,1-2,4H2,(H,20,21)(H,22,23)(H2,17,18,19)(H3,10,12,13,16)
SMILES:C(C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OCn1cnc2c1[nH]c(=N)nc2O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.