CymitQuimica logo

CAS 86764-30-9

:

N′-(4-Methylphenyl)-N,N-bis(phenylmethyl)urea

Description:
N′-(4-Methylphenyl)-N,N-bis(phenylmethyl)urea, with the CAS number 86764-30-9, is a chemical compound that belongs to the class of ureas. It features a urea functional group, characterized by the presence of a carbonyl group (C=O) bonded to two amine groups (NH). This specific compound is distinguished by its substitution pattern, which includes a 4-methylphenyl group and two phenylmethyl groups attached to the nitrogen atoms of the urea moiety. The presence of these aromatic groups contributes to its hydrophobic characteristics and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound may exhibit specific biological activities, making it of interest for research in medicinal chemistry. Its physical properties, such as solubility and melting point, can vary based on the molecular interactions and the presence of substituents. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C22H22N2O
InChI:InChI=1S/C22H22N2O/c1-18-12-14-21(15-13-18)23-22(25)24(16-19-8-4-2-5-9-19)17-20-10-6-3-7-11-20/h2-15H,16-17H2,1H3,(H,23,25)
InChI key:InChIKey=UQTSCLRTSKBRST-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(CC2=CC=CC=C2)C(NC3=CC=C(C)C=C3)=O
Synonyms:
  • N′-(4-Methylphenyl)-N,N-bis(phenylmethyl)urea
  • Urea, N′-(4-methylphenyl)-N,N-bis(phenylmethyl)-
  • 1,1-Dibenzyl-3-(p-tolyl)urea
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.