
CAS 86799-27-1
:5-[(Dimethylamino)methylene]-6,7-dihydro-4(5H)-benzofuranone
Description:
5-[(Dimethylamino)methylene]-6,7-dihydro-4(5H)-benzofuranone, identified by its CAS number 86799-27-1, is a chemical compound characterized by its unique structure that includes a benzofuranone moiety and a dimethylaminomethylene group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. It is often studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the dimethylamino group may enhance its solubility in polar solvents and influence its pharmacokinetic properties. Additionally, the compound may exhibit fluorescence, making it useful in various analytical applications. Its stability, solubility, and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, this compound represents a class of organic molecules that are of interest in both synthetic and applied chemistry.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c1-12(2)7-8-3-4-10-9(11(8)13)5-6-14-10/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=WYLQWUCWHMRGAF-UHFFFAOYSA-N
SMILES:O=C1C2=C(CCC1=CN(C)C)OC=C2
Synonyms:- 4(5H)-Benzofuranone, 5-[(dimethylamino)methylene]-6,7-dihydro-
- 5-[(Dimethylamino)methylene]-6,7-dihydro-4(5H)-benzofuranone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.