CAS 868-04-2
:ethyl 2-cyano-3-ethylpent-2-enoate
Description:
Ethyl 2-cyano-3-ethylpent-2-enoate, with the CAS number 868-04-2, is an organic compound characterized by its functional groups, including an ester and a nitrile. It features a cyano group (-CN) attached to a pentenoate structure, which contributes to its reactivity and potential applications in organic synthesis. The presence of the ethyl group enhances its solubility in organic solvents, making it useful in various chemical reactions. This compound typically exhibits a moderate boiling point and is likely to be a colorless to pale yellow liquid at room temperature. Its structure allows for participation in nucleophilic addition reactions, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, due to the presence of the cyano group, it may exhibit polar characteristics, influencing its interactions with other substances. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled. Overall, ethyl 2-cyano-3-ethylpent-2-enoate is a versatile compound in the field of organic chemistry.
Formula:C10H15NO2
InChI:InChI=1/C10H15NO2/c1-4-8(5-2)9(7-11)10(12)13-6-3/h4-6H2,1-3H3
SMILES:CCC(=C(C#N)C(=O)OCC)CC
Synonyms:- 2-Pentenoic Acid, 2-Cyano-3-Ethyl-, Ethyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ethyl 2-Cyano-3,3-diethylacrylate
CAS:Controlled ProductFormula:C10H15NO2Color and Shape:NeatMolecular weight:181.232Ethyl 2-Cyano-3,3-diethylacrylate-d6
CAS:Controlled Product<p>Applications Ethyl 2-Cyano-3,3-diethylacrylate-d6 is labelled Ethyl 2-Cyano-3,3-diethylacrylate (E907600) which is a product of Knoevenagel condensation. Ethyl 2-Cyano-3,3-diethylacrylate (E907600) can be synthesized to verify effectiveness of the silica catalysts for Knoevenagel condensation.<br>References Utting, K., et al., Appl. Catal. A-Gen., 232, 7 (2002); Luque, R., et al.: Experiments in Green and Sustainable Chemistry, 7 (2009); Macquarrie, D., et al.: Green Chem., 1, 195 (1999)<br></p>Formula:C10D6H9NO2Color and Shape:NeatMolecular weight:187.269Ethyl 2-cyano-3-ethylpent-2-enoate
CAS:<p>Versatile small molecule scaffold</p>Formula:C10H15NO2Purity:Min. 95%Molecular weight:181.23 g/mol

