CAS 86801-04-9
:1-(3-acetylphenyl)thiourea
Description:
1-(3-Acetylphenyl)thiourea, with the CAS number 86801-04-9, is an organic compound characterized by the presence of a thiourea functional group and an acetylphenyl moiety. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry and as a building block in organic synthesis. The thiourea group (-NH-C(=S)-NH-) is notable for its ability to form hydrogen bonds, which can influence the compound's solubility and reactivity. The acetylphenyl part of the molecule contributes to its aromatic character, enhancing stability and providing sites for further chemical modifications. This compound may exhibit biological activity, making it of interest for research in pharmacology. Its synthesis generally involves the reaction of an appropriate phenyl derivative with thiourea and an acetylating agent. As with many thiourea derivatives, it is important to handle this compound with care, considering potential toxicity and environmental impact. Overall, 1-(3-acetylphenyl)thiourea is a versatile compound with significant implications in various chemical and biological contexts.
Formula:C9H10N2OS
InChI:InChI=1/C9H10N2OS/c1-6(12)7-3-2-4-8(5-7)11-9(10)13/h2-5H,1H3,(H3,10,11,13)
SMILES:CC(=O)c1cccc(c1)NC(=N)S
Synonyms:- Thiourea, N-(3-acetylphenyl)-
- 1-(3-Acetylphenyl)thiourea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Acetylphenylthiourea
CAS:3-AcetylphenylthioureaFormula:C9H10N2OSPurity:98%Color and Shape: solidMolecular weight:194.25g/mol1-(3-Acetylphenyl)-2-thiourea
CAS:1-(3-Acetylphenyl)-2-thiourea is an antibacterial agent that has been shown to be effective against escherichia coli and staphylococcus aureus. It inhibits bacterial growth by inhibiting the synthesis of proteins, leading to cell death. The compound does not exhibit activity against subtilis or klebsiella but does inhibit the growth of escherichia coli and staphylococcus aureus at concentrations of 0.05 mg/ml. 1-(3-Acetylphenyl)-2-thiourea exhibits constant activity over a wide range of pH values, with the optimum pH being 5.5 to 6.5. The drug also exhibits constant activity in the presence of methanol or triethylamine as well as in the presence of subtilis or klebsiella, with slightly increased activity observed when triethylamine is used as a solvent.Formula:C9H10N2OSPurity:Min. 95%Color and Shape:PowderMolecular weight:194.25 g/mol


