CAS 868066-91-5

5-bromo-2-methyl-2,3-dihydro-1H-isoindol-1-one

Description:

5-Bromo-2-methyl-2,3-dihydro-1H-isoindol-1-one is a chemical compound characterized by its unique structure, which includes a bromine atom and a methyl group attached to an isoindole framework. This compound features a bicyclic structure that contributes to its potential biological activity. The presence of the bromine atom can enhance the compound's reactivity and influence its interactions with biological targets. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological pathways. Additionally, the dihydroisoindole moiety is often associated with diverse pharmacological properties, making it a subject of interest in drug discovery. Safety and handling precautions should be observed, as with many brominated compounds, due to potential toxicity and environmental concerns. Overall, 5-bromo-2-methyl-2,3-dihydro-1H-isoindol-1-one represents a valuable compound for further research and application in various chemical and biological fields.

Formula: C₉H₈BrNO

InChI: InChI=1/C9H8BrNO/c1-11-5-6-4-7(10)2-3-8(6)9(11)12/h2-4H,5H2,1H3

SMILES: CN1Cc2cc(ccc2C1=O)Br

Synonyms:

• 1H-isoindol-1-one, 5-bromo-2,3-dihydro-2-methyl-
• 5-Bromo-2-Methylisoindolin-1-One

5-Bromo-2-methylisoindolin-1-one

CAS: 868066-91-5

Formula: C₉H₈BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 226.0699

Ref: IN-DA003MHR

5-Bromo-2-methylisoindolin-1-one

CAS: 868066-91-5

5-Bromo-2-methylisoindolin-1-one

Purity: 97%

Molecular weight: 226.06992g/mol

Ref: 54-OR306525

5-Bromo-2-methylisoindolin-1-one

CAS: 868066-91-5

Formula: C₉H₈BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 226.073

Ref: 10-F233425