CAS 86819-98-9
:B-(2-Naphthalenylmethyl)boronic acid
Description:
B-(2-Naphthalenylmethyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a 2-naphthylmethyl moiety. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents such as methanol and dimethyl sulfoxide. It exhibits the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The boronic acid functionality allows for participation in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, this compound may exhibit properties such as fluorescence, depending on its environment and substituents, and can be utilized in the development of sensors or in drug delivery systems. Its reactivity and versatility make it a valuable building block in the synthesis of complex organic molecules. Safety precautions should be observed when handling this compound, as with all boronic acids, due to potential irritant properties.
Formula:C11H11BO2
InChI:InChI=1S/C11H11BO2/c13-12(14)8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7,13-14H,8H2
InChI key:InChIKey=FJZYKRAQRGAWGX-UHFFFAOYSA-N
SMILES:C(B(O)O)C1=CC2=C(C=C1)C=CC=C2
Synonyms:- 2-Naphthylmethylboronic acid
- 2-Naphthalenemethaneboronic acid
- B-(2-Naphthalenylmethyl)boronic acid
- Boronic acid, B-(2-naphthalenylmethyl)-
- Boronic acid, (2-naphthalenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
