CAS 86820-21-5
:4-(2-Amino-1-hydroxyethyl)-5-fluoro-1,2-benzenediol
Description:
4-(2-Amino-1-hydroxyethyl)-5-fluoro-1,2-benzenediol, with the CAS number 86820-21-5, is a chemical compound characterized by its unique structure, which includes a fluorine atom and an amino group attached to a benzene ring. This compound typically exhibits properties associated with both phenolic and amine functionalities, which can influence its reactivity and solubility in various solvents. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, while the amino group may enhance its basicity and ability to form salts. The fluorine substitution can affect the compound's electronic properties, potentially increasing its lipophilicity and altering its biological activity. Such compounds may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to their potential interactions with biological targets. Additionally, the compound's stability, melting point, and solubility characteristics would depend on the specific conditions under which it is studied. Overall, this compound represents a class of fluorinated phenolic amines with diverse applications in chemical research and drug development.
Formula:C8H10FNO3
InChI:InChI=1S/C8H10FNO3/c9-5-2-7(12)6(11)1-4(5)8(13)3-10/h1-2,8,11-13H,3,10H2
InChI key:InChIKey=SBUQBFTXTZSRMH-UHFFFAOYSA-N
SMILES:C(CN)(O)C1=C(F)C=C(O)C(O)=C1
Synonyms:- 1,2-Benzenediol, 4-(2-Amino-1-Hydroxyethyl)-5-Fluoro-
- 4-(2-Amino-1-hydroxyethyl)-5-fluoro-1,2-benzenediol
- 6-Fluoronorepinephrine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.