CymitQuimica logo

CAS 868238-06-6

:

2-(2-Thienyl)-1H-indole-3-acetic acid

Description:
2-(2-Thienyl)-1H-indole-3-acetic acid is a chemical compound characterized by its unique structure, which combines an indole moiety with a thienyl group and an acetic acid functional group. This compound typically exhibits properties associated with both indole and thienyl derivatives, such as potential biological activity and solubility in organic solvents. The presence of the thienyl ring may impart specific electronic and steric properties, influencing its reactivity and interactions with biological targets. As an indole derivative, it may also exhibit properties related to neurotransmitter modulation or other pharmacological activities. The acetic acid group contributes to its acidity and potential for forming salts or esters. Overall, 2-(2-Thienyl)-1H-indole-3-acetic acid is of interest in medicinal chemistry and may be explored for its therapeutic potential, although specific applications and biological activities would require further investigation and validation through experimental studies.
Formula:C14H11NO2S
InChI:InChI=1S/C14H11NO2S/c16-13(17)8-10-9-4-1-2-5-11(9)15-14(10)12-6-3-7-18-12/h1-7,15H,8H2,(H,16,17)
InChI key:InChIKey=XIOJJFZMRZMUDZ-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(NC=2C1=CC=CC2)C3=CC=CS3
Synonyms:
  • 1H-Indole-3-acetic acid, 2-(2-thienyl)-
  • 2-(2-Thienyl)-1H-indole-3-acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.