CAS 868245-03-8
:5-piperazin-1-yl-2,3-dihydro-1H-inden-1-one
Description:
5-Piperazin-1-yl-2,3-dihydro-1H-inden-1-one is a chemical compound characterized by its unique bicyclic structure, which includes a piperazine ring and an indene moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The presence of the piperazine group suggests that it may exhibit basic properties due to the nitrogen atoms, which can participate in hydrogen bonding and interact with biological targets. The indene structure contributes to its aromatic characteristics, potentially influencing its reactivity and stability. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological activities, as piperazine derivatives are often explored for their therapeutic effects. Additionally, its molecular structure may allow for various modifications, making it a candidate for further research in drug development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H16N2O
InChI:InChI=1/C13H16N2O/c16-13-4-1-10-9-11(2-3-12(10)13)15-7-5-14-6-8-15/h2-3,9,14H,1,4-8H2
SMILES:C1CC(=O)c2ccc(cc12)N1CCNCC1
Synonyms:- 1H-inden-1-one, 2,3-dihydro-5-(1-piperazinyl)-
- 5-(Piperazin-1-yl)indan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
